C20H23N3O4S2 — CID 24678207
2-[4-(2,4,6-trimethylphenyl)sulfonylpiperazin-1-yl]sulfonylbenzonitrile (PubChem CID 24678207) has the molecular formula C20H23N3O4S2 and a molecular weight of 433.56 g/mol. Its IUPAC name is 2-[4-(2,4,6-trimethylphenyl)sulfonylpiperazin-1-yl]sulfonylbenzonitrile.
| Compound Name | 2-[4-(2,4,6-trimethylphenyl)sulfonylpiperazin-1-yl]sulfonylbenzonitrile |
|---|---|
| PubChem CID | 24678207 |
| Molecular Formula | C20H23N3O4S2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | 2-[4-(2,4,6-trimethylphenyl)sulfonylpiperazin-1-yl]sulfonylbenzonitrile |
| SMILES | Cc1cc(C)c(S(=O)(=O)N2CCN(S(=O)(=O)c3ccccc3C#N)CC2)c(C)c1 |
| InChI | InChI=1S/C20H23N3O4S2/c1-15-12-16(2)20(17(3)13-15)29(26,27)23-10-8-22(9-11-23)28(24,25)19-7-5-4-6-18(19)14-21/h4-7,12-13H,8-11H2,1-3H3 |
| InChIKey | MXSQBGZWGFEJDF-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 98.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |