C20H19N5O2S — CID 31012765
2-[4-(3-methylquinoxalin-2-yl)piperazin-1-yl]sulfonylbenzonitrile (PubChem CID 31012765) has the molecular formula C20H19N5O2S and a molecular weight of 393.47 g/mol. Its IUPAC name is 2-[4-(3-methylquinoxalin-2-yl)piperazin-1-yl]sulfonylbenzonitrile.
| Compound Name | 2-[4-(3-methylquinoxalin-2-yl)piperazin-1-yl]sulfonylbenzonitrile |
|---|---|
| PubChem CID | 31012765 |
| Molecular Formula | C20H19N5O2S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 2-[4-(3-methylquinoxalin-2-yl)piperazin-1-yl]sulfonylbenzonitrile |
| SMILES | Cc1nc2ccccc2nc1N1CCN(S(=O)(=O)c2ccccc2C#N)CC1 |
| InChI | InChI=1S/C20H19N5O2S/c1-15-20(23-18-8-4-3-7-17(18)22-15)24-10-12-25(13-11-24)28(26,27)19-9-5-2-6-16(19)14-21/h2-9H,10-13H2,1H3 |
| InChIKey | MYCLZZPTJBGWHG-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 90.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |