C19H19BrN4O2S — CID 31014988
2-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]-3-methylquinoxaline (PubChem CID 31014988) has the molecular formula C19H19BrN4O2S and a molecular weight of 447.36 g/mol. Its IUPAC name is 2-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]-3-methylquinoxaline.
| Compound Name | 2-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]-3-methylquinoxaline |
|---|---|
| PubChem CID | 31014988 |
| Molecular Formula | C19H19BrN4O2S |
| Molecular Weight | 447.36 g/mol |
| Exact Mass | 446.04 |
| IUPAC Name | 2-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]-3-methylquinoxaline |
| SMILES | Cc1nc2ccccc2nc1N1CCN(S(=O)(=O)c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C19H19BrN4O2S/c1-14-19(22-18-5-3-2-4-17(18)21-14)23-10-12-24(13-11-23)27(25,26)16-8-6-15(20)7-9-16/h2-9H,10-13H2,1H3 |
| InChIKey | HRRHYYFOSCRBIR-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.36 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |