C17H18ClFN2O4S2 — CID 39622444
1-(2-chlorophenyl)sulfonyl-4-(3-fluoro-4-methylphenyl)sulfonylpiperazine (PubChem CID 39622444) has the molecular formula C17H18ClFN2O4S2 and a molecular weight of 432.93 g/mol. Its IUPAC name is 1-(2-chlorophenyl)sulfonyl-4-(3-fluoro-4-methylphenyl)sulfonylpiperazine.
| Compound Name | 1-(2-chlorophenyl)sulfonyl-4-(3-fluoro-4-methylphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 39622444 |
| Molecular Formula | C17H18ClFN2O4S2 |
| Molecular Weight | 432.93 g/mol |
| Exact Mass | 432.04 |
| IUPAC Name | 1-(2-chlorophenyl)sulfonyl-4-(3-fluoro-4-methylphenyl)sulfonylpiperazine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(S(=O)(=O)c3ccccc3Cl)CC2)cc1F |
| InChI | InChI=1S/C17H18ClFN2O4S2/c1-13-6-7-14(12-16(13)19)26(22,23)20-8-10-21(11-9-20)27(24,25)17-5-3-2-4-15(17)18/h2-7,12H,8-11H2,1H3 |
| InChIKey | BNKVBIBLBGPTMD-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.93 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |