C15H22N2O4S2 — CID 646959
1-(4-methyl-3-pyrrolidin-1-ylsulfonylphenyl)sulfonylpyrrolidine (PubChem CID 646959) has the molecular formula C15H22N2O4S2 and a molecular weight of 358.49 g/mol. Its IUPAC name is 1-(4-methyl-3-pyrrolidin-1-ylsulfonylphenyl)sulfonylpyrrolidine.
| Compound Name | 1-(4-methyl-3-pyrrolidin-1-ylsulfonylphenyl)sulfonylpyrrolidine |
|---|---|
| PubChem CID | 646959 |
| Molecular Formula | C15H22N2O4S2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 1-(4-methyl-3-pyrrolidin-1-ylsulfonylphenyl)sulfonylpyrrolidine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCC2)cc1S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C15H22N2O4S2/c1-13-6-7-14(22(18,19)16-8-2-3-9-16)12-15(13)23(20,21)17-10-4-5-11-17/h6-7,12H,2-5,8-11H2,1H3 |
| InChIKey | HTLHFOKVLNSBBD-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |