C18H24N4O4S2 — CID 71875967
1-(4-methyl-3-pyrrolidin-1-ylsulfonylphenyl)-4-pyrrolidin-1-ylsulfonylpyrazole (PubChem CID 71875967) has the molecular formula C18H24N4O4S2 and a molecular weight of 424.55 g/mol. Its IUPAC name is 1-(4-methyl-3-pyrrolidin-1-ylsulfonylphenyl)-4-pyrrolidin-1-ylsulfonylpyrazole.
| Compound Name | 1-(4-methyl-3-pyrrolidin-1-ylsulfonylphenyl)-4-pyrrolidin-1-ylsulfonylpyrazole |
|---|---|
| PubChem CID | 71875967 |
| Molecular Formula | C18H24N4O4S2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 1-(4-methyl-3-pyrrolidin-1-ylsulfonylphenyl)-4-pyrrolidin-1-ylsulfonylpyrazole |
| SMILES | Cc1ccc(-n2cc(S(=O)(=O)N3CCCC3)cn2)cc1S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C18H24N4O4S2/c1-15-6-7-16(12-18(15)28(25,26)21-10-4-5-11-21)22-14-17(13-19-22)27(23,24)20-8-2-3-9-20/h6-7,12-14H,2-5,8-11H2,1H3 |
| InChIKey | WAUXFDMOEDTDBN-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 92.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |