C18H24N2O2S — CID 2359920
1-[3-(2,5-dimethylpyrrol-1-yl)-4-methylphenyl]sulfonylpiperidine (PubChem CID 2359920) has the molecular formula C18H24N2O2S and a molecular weight of 332.47 g/mol. Its IUPAC name is 1-[3-(2,5-dimethylpyrrol-1-yl)-4-methylphenyl]sulfonylpiperidine.
| Compound Name | 1-[3-(2,5-dimethylpyrrol-1-yl)-4-methylphenyl]sulfonylpiperidine |
|---|---|
| PubChem CID | 2359920 |
| Molecular Formula | C18H24N2O2S |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 1-[3-(2,5-dimethylpyrrol-1-yl)-4-methylphenyl]sulfonylpiperidine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCCC2)cc1-n1c(C)ccc1C |
| InChI | InChI=1S/C18H24N2O2S/c1-14-7-10-17(23(21,22)19-11-5-4-6-12-19)13-18(14)20-15(2)8-9-16(20)3/h7-10,13H,4-6,11-12H2,1-3H3 |
| InChIKey | RJYNSULDOHGVIN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|