C22H29N3O4S2 — CID 650477
1-(2,5-dimethylphenyl)-4-(3-pyrrolidin-1-ylsulfonylphenyl)sulfonylpiperazine (PubChem CID 650477) has the molecular formula C22H29N3O4S2 and a molecular weight of 463.63 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-4-(3-pyrrolidin-1-ylsulfonylphenyl)sulfonylpiperazine.
| Compound Name | 1-(2,5-dimethylphenyl)-4-(3-pyrrolidin-1-ylsulfonylphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 650477 |
| Molecular Formula | C22H29N3O4S2 |
| Molecular Weight | 463.63 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-4-(3-pyrrolidin-1-ylsulfonylphenyl)sulfonylpiperazine |
| SMILES | Cc1ccc(C)c(N2CCN(S(=O)(=O)c3cccc(S(=O)(=O)N4CCCC4)c3)CC2)c1 |
| InChI | InChI=1S/C22H29N3O4S2/c1-18-8-9-19(2)22(16-18)23-12-14-25(15-13-23)31(28,29)21-7-5-6-20(17-21)30(26,27)24-10-3-4-11-24/h5-9,16-17H,3-4,10-15H2,1-2H3 |
| InChIKey | XGZCETJJNRDHMZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.63 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |