C19H21F3N2O3S — CID 167932774
1-(2,4-dimethylphenyl)-4-[3-(trifluoromethoxy)phenyl]sulfonylpiperazine (PubChem CID 167932774) has the molecular formula C19H21F3N2O3S and a molecular weight of 414.45 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-4-[3-(trifluoromethoxy)phenyl]sulfonylpiperazine.
| Compound Name | 1-(2,4-dimethylphenyl)-4-[3-(trifluoromethoxy)phenyl]sulfonylpiperazine |
|---|---|
| PubChem CID | 167932774 |
| Molecular Formula | C19H21F3N2O3S |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-4-[3-(trifluoromethoxy)phenyl]sulfonylpiperazine |
| SMILES | Cc1ccc(N2CCN(S(=O)(=O)c3cccc(OC(F)(F)F)c3)CC2)c(C)c1 |
| InChI | InChI=1S/C19H21F3N2O3S/c1-14-6-7-18(15(2)12-14)23-8-10-24(11-9-23)28(25,26)17-5-3-4-16(13-17)27-19(20,21)22/h3-7,12-13H,8-11H2,1-2H3 |
| InChIKey | IQKZEPPEJHJYMY-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |