C14H19F3N2O3S — CID 119975025
1-[1-[3-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-yl]ethanamine (PubChem CID 119975025) has the molecular formula C14H19F3N2O3S and a molecular weight of 352.38 g/mol. Its IUPAC name is 1-[1-[3-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-yl]ethanamine.
| Compound Name | 1-[1-[3-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-yl]ethanamine |
|---|---|
| PubChem CID | 119975025 |
| Molecular Formula | C14H19F3N2O3S |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 1-[1-[3-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-yl]ethanamine |
| SMILES | CC(N)C1CCN(S(=O)(=O)c2cccc(OC(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C14H19F3N2O3S/c1-10(18)11-5-7-19(8-6-11)23(20,21)13-4-2-3-12(9-13)22-14(15,16)17/h2-4,9-11H,5-8,18H2,1H3 |
| InChIKey | UGGHJZRCQQTRPZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |