C19H24F3N3O5S — CID 31937683
1-[1-[3-(trifluoromethoxy)phenyl]sulfonylpiperidine-4-carbonyl]piperidine-4-carboxamide (PubChem CID 31937683) has the molecular formula C19H24F3N3O5S and a molecular weight of 463.48 g/mol. Its IUPAC name is 1-[1-[3-(trifluoromethoxy)phenyl]sulfonylpiperidine-4-carbonyl]piperidine-4-carboxamide.
| Compound Name | 1-[1-[3-(trifluoromethoxy)phenyl]sulfonylpiperidine-4-carbonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 31937683 |
| Molecular Formula | C19H24F3N3O5S |
| Molecular Weight | 463.48 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | 1-[1-[3-(trifluoromethoxy)phenyl]sulfonylpiperidine-4-carbonyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C(=O)C2CCN(S(=O)(=O)c3cccc(OC(F)(F)F)c3)CC2)CC1 |
| InChI | InChI=1S/C19H24F3N3O5S/c20-19(21,22)30-15-2-1-3-16(12-15)31(28,29)25-10-6-14(7-11-25)18(27)24-8-4-13(5-9-24)17(23)26/h1-3,12-14H,4-11H2,(H2,23,26) |
| InChIKey | ZXYDHZAAQLQFBM-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.48 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |