C18H18F3N3O4S — CID 25332101
N-pyridin-2-yl-1-[3-(trifluoromethoxy)phenyl]sulfonylpiperidine-4-carboxamide (PubChem CID 25332101) has the molecular formula C18H18F3N3O4S and a molecular weight of 429.42 g/mol. Its IUPAC name is N-pyridin-2-yl-1-[3-(trifluoromethoxy)phenyl]sulfonylpiperidine-4-carboxamide.
| Compound Name | N-pyridin-2-yl-1-[3-(trifluoromethoxy)phenyl]sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 25332101 |
| Molecular Formula | C18H18F3N3O4S |
| Molecular Weight | 429.42 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | N-pyridin-2-yl-1-[3-(trifluoromethoxy)phenyl]sulfonylpiperidine-4-carboxamide |
| SMILES | O=C(Nc1ccccn1)C1CCN(S(=O)(=O)c2cccc(OC(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C18H18F3N3O4S/c19-18(20,21)28-14-4-3-5-15(12-14)29(26,27)24-10-7-13(8-11-24)17(25)23-16-6-1-2-9-22-16/h1-6,9,12-13H,7-8,10-11H2,(H,22,23,25) |
| InChIKey | RDGRDBPGUQYXEW-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |