C18H19F3N4O5S — CID 44553622
1-pyridin-2-yl-3-[1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-yl]oxyurea (PubChem CID 44553622) has the molecular formula C18H19F3N4O5S and a molecular weight of 460.43 g/mol. Its IUPAC name is 1-pyridin-2-yl-3-[1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-yl]oxyurea.
| Compound Name | 1-pyridin-2-yl-3-[1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-yl]oxyurea |
|---|---|
| PubChem CID | 44553622 |
| Molecular Formula | C18H19F3N4O5S |
| Molecular Weight | 460.43 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | 1-pyridin-2-yl-3-[1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-yl]oxyurea |
| SMILES | O=C(NOC1CCN(S(=O)(=O)c2ccc(OC(F)(F)F)cc2)CC1)Nc1ccccn1 |
| InChI | InChI=1S/C18H19F3N4O5S/c19-18(20,21)29-13-4-6-15(7-5-13)31(27,28)25-11-8-14(9-12-25)30-24-17(26)23-16-3-1-2-10-22-16/h1-7,10,14H,8-9,11-12H2,(H2,22,23,24,26) |
| InChIKey | FQBVBGYPGBJYKN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|