C18H19F3N2O4S — CID 90566588
2-methyl-5-[1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-yl]oxypyridine (PubChem CID 90566588) has the molecular formula C18H19F3N2O4S and a molecular weight of 416.42 g/mol. Its IUPAC name is 2-methyl-5-[1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-yl]oxypyridine.
| Compound Name | 2-methyl-5-[1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-yl]oxypyridine |
|---|---|
| PubChem CID | 90566588 |
| Molecular Formula | C18H19F3N2O4S |
| Molecular Weight | 416.42 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 2-methyl-5-[1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-yl]oxypyridine |
| SMILES | Cc1ccc(OC2CCN(S(=O)(=O)c3ccc(OC(F)(F)F)cc3)CC2)cn1 |
| InChI | InChI=1S/C18H19F3N2O4S/c1-13-2-3-16(12-22-13)26-14-8-10-23(11-9-14)28(24,25)17-6-4-15(5-7-17)27-18(19,20)21/h2-7,12,14H,8-11H2,1H3 |
| InChIKey | JWHMKSJLMLIROR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.42 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |