C11H14F3N2O3S+ — CID 2079401
1-[4-(trifluoromethoxy)phenyl]sulfonylpiperazin-4-ium (PubChem CID 2079401) has the molecular formula C11H14F3N2O3S+ and a molecular weight of 311.31 g/mol. Its IUPAC name is 1-[4-(trifluoromethoxy)phenyl]sulfonylpiperazin-4-ium.
| Compound Name | 1-[4-(trifluoromethoxy)phenyl]sulfonylpiperazin-4-ium |
|---|---|
| PubChem CID | 2079401 |
| Molecular Formula | C11H14F3N2O3S+ |
| Molecular Weight | 311.31 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 1-[4-(trifluoromethoxy)phenyl]sulfonylpiperazin-4-ium |
| SMILES | O=S(=O)(c1ccc(OC(F)(F)F)cc1)N1CC[NH2+]CC1 |
| InChI | InChI=1S/C11H13F3N2O3S/c12-11(13,14)19-9-1-3-10(4-2-9)20(17,18)16-7-5-15-6-8-16/h1-4,15H,5-8H2/p+1 |
| InChIKey | YNZSAWALMDCRMX-UHFFFAOYSA-O |
| XLogP | 0.15 |
| TPSA | 63.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.31 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |