C16H21F3N2O4S — CID 118314272
4-[1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-yl]morpholine (PubChem CID 118314272) has the molecular formula C16H21F3N2O4S and a molecular weight of 394.42 g/mol. Its IUPAC name is 4-[1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-yl]morpholine.
| Compound Name | 4-[1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-yl]morpholine |
|---|---|
| PubChem CID | 118314272 |
| Molecular Formula | C16H21F3N2O4S |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 4-[1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-yl]morpholine |
| SMILES | O=S(=O)(c1ccc(OC(F)(F)F)cc1)N1CCC(N2CCOCC2)CC1 |
| InChI | InChI=1S/C16H21F3N2O4S/c17-16(18,19)25-14-1-3-15(4-2-14)26(22,23)21-7-5-13(6-8-21)20-9-11-24-12-10-20/h1-4,13H,5-12H2 |
| InChIKey | QTTBKJXFTUCSMY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |