C14H18F3N3O3S — CID 129398340
4-[(3R)-1-[[6-(trifluoromethyl)-3-pyridinyl]sulfonyl]pyrrolidin-3-yl]morpholine (PubChem CID 129398340) has the molecular formula C14H18F3N3O3S and a molecular weight of 365.38 g/mol. Its IUPAC name is 4-[(3R)-1-[[6-(trifluoromethyl)-3-pyridinyl]sulfonyl]pyrrolidin-3-yl]morpholine.
| Compound Name | 4-[(3R)-1-[[6-(trifluoromethyl)-3-pyridinyl]sulfonyl]pyrrolidin-3-yl]morpholine |
|---|---|
| PubChem CID | 129398340 |
| Molecular Formula | C14H18F3N3O3S |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 4-[(3R)-1-[[6-(trifluoromethyl)-3-pyridinyl]sulfonyl]pyrrolidin-3-yl]morpholine |
| SMILES | O=S(=O)(c1ccc(C(F)(F)F)nc1)N1CC[C@@H](N2CCOCC2)C1 |
| InChI | InChI=1S/C14H18F3N3O3S/c15-14(16,17)13-2-1-12(9-18-13)24(21,22)20-4-3-11(10-20)19-5-7-23-8-6-19/h1-2,9,11H,3-8,10H2/t11-/m1/s1 |
| InChIKey | HXBVBZIAAFHMOW-LLVKDONJSA-N |
| XLogP | 1.20 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |