C15H21FN2O2S — CID 63169006
1-[1-(4-fluorophenyl)sulfonylpyrrolidin-3-yl]piperidine (PubChem CID 63169006) has the molecular formula C15H21FN2O2S and a molecular weight of 312.41 g/mol. Its IUPAC name is 1-[1-(4-fluorophenyl)sulfonylpyrrolidin-3-yl]piperidine.
| Compound Name | 1-[1-(4-fluorophenyl)sulfonylpyrrolidin-3-yl]piperidine |
|---|---|
| PubChem CID | 63169006 |
| Molecular Formula | C15H21FN2O2S |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 1-[1-(4-fluorophenyl)sulfonylpyrrolidin-3-yl]piperidine |
| SMILES | O=S(=O)(c1ccc(F)cc1)N1CCC(N2CCCCC2)C1 |
| InChI | InChI=1S/C15H21FN2O2S/c16-13-4-6-15(7-5-13)21(19,20)18-11-8-14(12-18)17-9-2-1-3-10-17/h4-7,14H,1-3,8-12H2 |
| InChIKey | CACIAJYTFTZGPI-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |