C20H28FN3O3S — CID 110246552
(4-cyclopentylpiperazin-1-yl)-[1-(4-fluorophenyl)sulfonylpyrrolidin-3-yl]methanone (PubChem CID 110246552) has the molecular formula C20H28FN3O3S and a molecular weight of 409.53 g/mol. Its IUPAC name is (4-cyclopentylpiperazin-1-yl)-[1-(4-fluorophenyl)sulfonylpyrrolidin-3-yl]methanone.
| Compound Name | (4-cyclopentylpiperazin-1-yl)-[1-(4-fluorophenyl)sulfonylpyrrolidin-3-yl]methanone |
|---|---|
| PubChem CID | 110246552 |
| Molecular Formula | C20H28FN3O3S |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | (4-cyclopentylpiperazin-1-yl)-[1-(4-fluorophenyl)sulfonylpyrrolidin-3-yl]methanone |
| SMILES | O=C(C1CCN(S(=O)(=O)c2ccc(F)cc2)C1)N1CCN(C2CCCC2)CC1 |
| InChI | InChI=1S/C20H28FN3O3S/c21-17-5-7-19(8-6-17)28(26,27)24-10-9-16(15-24)20(25)23-13-11-22(12-14-23)18-3-1-2-4-18/h5-8,16,18H,1-4,9-15H2 |
| InChIKey | ONBQITJXEFLBCF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |