C10H13FN2O2S — CID 62067673
1-(4-fluorophenyl)sulfonylpyrrolidin-3-amine (PubChem CID 62067673) has the molecular formula C10H13FN2O2S and a molecular weight of 244.29 g/mol. Its IUPAC name is 1-(4-fluorophenyl)sulfonylpyrrolidin-3-amine.
| Compound Name | 1-(4-fluorophenyl)sulfonylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 62067673 |
| Molecular Formula | C10H13FN2O2S |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 1-(4-fluorophenyl)sulfonylpyrrolidin-3-amine |
| SMILES | NC1CCN(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C10H13FN2O2S/c11-8-1-3-10(4-2-8)16(14,15)13-6-5-9(12)7-13/h1-4,9H,5-7,12H2 |
| InChIKey | TZFZDEMJWTZOLX-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |