C11H17ClN2O2S — CID 119962425
(3R)-1-(4-methylphenyl)sulfonylpyrrolidin-3-amine;hydrochloride (PubChem CID 119962425) has the molecular formula C11H17ClN2O2S and a molecular weight of 276.79 g/mol. Its IUPAC name is (3R)-1-(4-methylphenyl)sulfonylpyrrolidin-3-amine;hydrochloride.
| Compound Name | (3R)-1-(4-methylphenyl)sulfonylpyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 119962425 |
| Molecular Formula | C11H17ClN2O2S |
| Molecular Weight | 276.79 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | (3R)-1-(4-methylphenyl)sulfonylpyrrolidin-3-amine;hydrochloride |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[C@@H](N)C2)cc1.Cl |
| InChI | InChI=1S/C11H16N2O2S.ClH/c1-9-2-4-11(5-3-9)16(14,15)13-7-6-10(12)8-13;/h2-5,10H,6-8,12H2,1H3;1H/t10-;/m1./s1 |
| InChIKey | UCBBXGHPZIAXTA-HNCPQSOCSA-N |
| XLogP | 1.14 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.79 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |