C12H19ClN2O3S — CID 119962752
(3R)-1-(4-methoxy-3-methylphenyl)sulfonylpyrrolidin-3-amine;hydrochloride (PubChem CID 119962752) has the molecular formula C12H19ClN2O3S and a molecular weight of 306.81 g/mol. Its IUPAC name is (3R)-1-(4-methoxy-3-methylphenyl)sulfonylpyrrolidin-3-amine;hydrochloride.
| Compound Name | (3R)-1-(4-methoxy-3-methylphenyl)sulfonylpyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 119962752 |
| Molecular Formula | C12H19ClN2O3S |
| Molecular Weight | 306.81 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | (3R)-1-(4-methoxy-3-methylphenyl)sulfonylpyrrolidin-3-amine;hydrochloride |
| SMILES | COc1ccc(S(=O)(=O)N2CC[C@@H](N)C2)cc1C.Cl |
| InChI | InChI=1S/C12H18N2O3S.ClH/c1-9-7-11(3-4-12(9)17-2)18(15,16)14-6-5-10(13)8-14;/h3-4,7,10H,5-6,8,13H2,1-2H3;1H/t10-;/m1./s1 |
| InChIKey | BPLSSQQAWWEFIG-HNCPQSOCSA-N |
| XLogP | 1.15 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.81 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |