C21H28N2O6S2 — CID 4598462
1,4-bis[(4-methoxy-3-methylphenyl)sulfonyl]-2-methylpiperazine (PubChem CID 4598462) has the molecular formula C21H28N2O6S2 and a molecular weight of 468.60 g/mol. Its IUPAC name is 1,4-bis[(4-methoxy-3-methylphenyl)sulfonyl]-2-methylpiperazine.
| Compound Name | 1,4-bis[(4-methoxy-3-methylphenyl)sulfonyl]-2-methylpiperazine |
|---|---|
| PubChem CID | 4598462 |
| Molecular Formula | C21H28N2O6S2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | 1,4-bis[(4-methoxy-3-methylphenyl)sulfonyl]-2-methylpiperazine |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(S(=O)(=O)c3ccc(OC)c(C)c3)C(C)C2)cc1C |
| InChI | InChI=1S/C21H28N2O6S2/c1-15-12-18(6-8-20(15)28-4)30(24,25)22-10-11-23(17(3)14-22)31(26,27)19-7-9-21(29-5)16(2)13-19/h6-9,12-13,17H,10-11,14H2,1-5H3 |
| InChIKey | SIDSHKMMDCTKIL-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |