C19H24N2O6S2 — CID 51708398
(2R)-1,4-bis[(4-methoxyphenyl)sulfonyl]-2-methylpiperazine (PubChem CID 51708398) has the molecular formula C19H24N2O6S2 and a molecular weight of 440.54 g/mol. Its IUPAC name is (2R)-1,4-bis[(4-methoxyphenyl)sulfonyl]-2-methylpiperazine.
| Compound Name | (2R)-1,4-bis[(4-methoxyphenyl)sulfonyl]-2-methylpiperazine |
|---|---|
| PubChem CID | 51708398 |
| Molecular Formula | C19H24N2O6S2 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | (2R)-1,4-bis[(4-methoxyphenyl)sulfonyl]-2-methylpiperazine |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(S(=O)(=O)c3ccc(OC)cc3)[C@H](C)C2)cc1 |
| InChI | InChI=1S/C19H24N2O6S2/c1-15-14-20(28(22,23)18-8-4-16(26-2)5-9-18)12-13-21(15)29(24,25)19-10-6-17(27-3)7-11-19/h4-11,15H,12-14H2,1-3H3/t15-/m1/s1 |
| InChIKey | MCGWXIKBYQBLFA-OAHLLOKOSA-N |
| XLogP | 1.79 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |