C23H32N2O4S2 — CID 2899373
2-methyl-1,4-bis[(4-propan-2-ylphenyl)sulfonyl]piperazine (PubChem CID 2899373) has the molecular formula C23H32N2O4S2 and a molecular weight of 464.65 g/mol. Its IUPAC name is 2-methyl-1,4-bis[(4-propan-2-ylphenyl)sulfonyl]piperazine.
| Compound Name | 2-methyl-1,4-bis[(4-propan-2-ylphenyl)sulfonyl]piperazine |
|---|---|
| PubChem CID | 2899373 |
| Molecular Formula | C23H32N2O4S2 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 2-methyl-1,4-bis[(4-propan-2-ylphenyl)sulfonyl]piperazine |
| SMILES | CC(C)c1ccc(S(=O)(=O)N2CCN(S(=O)(=O)c3ccc(C(C)C)cc3)C(C)C2)cc1 |
| InChI | InChI=1S/C23H32N2O4S2/c1-17(2)20-6-10-22(11-7-20)30(26,27)24-14-15-25(19(5)16-24)31(28,29)23-12-8-21(9-13-23)18(3)4/h6-13,17-19H,14-16H2,1-5H3 |
| InChIKey | DQIVPQGECINPCD-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |