C21H28N2O4S2 — CID 2896880
1,4-bis[(3,4-dimethylphenyl)sulfonyl]-2-methylpiperazine (PubChem CID 2896880) has the molecular formula C21H28N2O4S2 and a molecular weight of 436.60 g/mol. Its IUPAC name is 1,4-bis[(3,4-dimethylphenyl)sulfonyl]-2-methylpiperazine.
| Compound Name | 1,4-bis[(3,4-dimethylphenyl)sulfonyl]-2-methylpiperazine |
|---|---|
| PubChem CID | 2896880 |
| Molecular Formula | C21H28N2O4S2 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 1,4-bis[(3,4-dimethylphenyl)sulfonyl]-2-methylpiperazine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(S(=O)(=O)c3ccc(C)c(C)c3)C(C)C2)cc1C |
| InChI | InChI=1S/C21H28N2O4S2/c1-15-6-8-20(12-17(15)3)28(24,25)22-10-11-23(19(5)14-22)29(26,27)21-9-7-16(2)18(4)13-21/h6-9,12-13,19H,10-11,14H2,1-5H3 |
| InChIKey | DQRPVDMXWOBBCL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |