About (2S)-1,4-bis(dibenzofuran-2-ylsulfonyl)-2-methylpiperazine
(2S)-1,4-bis(dibenzofuran-2-ylsulfonyl)-2-methylpiperazine (PubChem CID 92853639) has the molecular formula C29H24N2O6S2
and a molecular weight of 560.65 g/mol. Its IUPAC name is (2S)-1,4-bis(dibenzofuran-2-ylsulfonyl)-2-methylpiperazine.
Molecular Properties
| Compound Name | (2S)-1,4-bis(dibenzofuran-2-ylsulfonyl)-2-methylpiperazine |
| PubChem CID | 92853639 |
| Molecular Formula | C29H24N2O6S2 |
| Molecular Weight | 560.65 g/mol |
| Exact Mass | 560.11 |
| IUPAC Name | (2S)-1,4-bis(dibenzofuran-2-ylsulfonyl)-2-methylpiperazine |
| SMILES | C[C@H]1CN(S(=O)(=O)c2ccc3oc4ccccc4c3c2)CCN1S(=O)(=O)c1ccc2oc3ccccc3c2c1 |
| InChI | InChI=1S/C29H24N2O6S2/c1-19-18-30(38(32,33)20-10-12-28-24(16-20)22-6-2-4-8-26(22)36-28)14-15-31(19)39(34,35)21-11-13-29-25(17-21)23-7-3-5-9-27(23)37-29/h2-13,16-17,19H,14-15,18H2,1H3/t19-/m0/s1 |
| InChIKey | LRCRRPOEIJDTSF-IBGZPJMESA-N |
| XLogP | 5.57 |
| TPSA | 101.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 560.65 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2S)-1,4-bis(dibenzofuran-2-ylsulfonyl)-2-methylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1,4-bis(dibenzofuran-2-ylsulfonyl)-2-methylpiperazine?
The IUPAC name of (2S)-1,4-bis(dibenzofuran-2-ylsulfonyl)-2-methylpiperazine (CID 92853639) is (2S)-1,4-bis(dibenzofuran-2-ylsulfonyl)-2-methylpiperazine.
What is the SMILES notation for (2S)-1,4-bis(dibenzofuran-2-ylsulfonyl)-2-methylpiperazine?
The canonical SMILES for (2S)-1,4-bis(dibenzofuran-2-ylsulfonyl)-2-methylpiperazine is C[C@H]1CN(S(=O)(=O)c2ccc3oc4ccccc4c3c2)CCN1S(=O)(=O)c1ccc2oc3ccccc3c2c1.
What is the InChIKey of (2S)-1,4-bis(dibenzofuran-2-ylsulfonyl)-2-methylpiperazine?
The InChIKey is LRCRRPOEIJDTSF-IBGZPJMESA-N. The full InChI is InChI=1S/C29H24N2O6S2/c1-19-18-30(38(32,33)20-10-12-28-24(16-20)22-6-2-4-8-26(22)36-28)14-15-31(19)39(34,35)21-11-13-29-25(17-21)23-7-3-5-9-27(23)37-29/h2-13,16-17,19H,14-15,18H2,1H3/t19-/m0/s1.
What are the key properties of (2S)-1,4-bis(dibenzofuran-2-ylsulfonyl)-2-methylpiperazine?
(2S)-1,4-bis(dibenzofuran-2-ylsulfonyl)-2-methylpiperazine has a molecular weight of 560.65 g/mol, XLogP of 5.57, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1,4-bis(dibenzofuran-2-ylsulfonyl)-2-methylpiperazine is sourced from PubChem (CID 92853639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).