C16H18N2O4S2 — CID 124927772
(4R)-1,3-bis(benzenesulfonyl)-4-methylimidazolidine (PubChem CID 124927772) has the molecular formula C16H18N2O4S2 and a molecular weight of 366.46 g/mol. Its IUPAC name is (4R)-1,3-bis(benzenesulfonyl)-4-methylimidazolidine.
| Compound Name | (4R)-1,3-bis(benzenesulfonyl)-4-methylimidazolidine |
|---|---|
| PubChem CID | 124927772 |
| Molecular Formula | C16H18N2O4S2 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | (4R)-1,3-bis(benzenesulfonyl)-4-methylimidazolidine |
| SMILES | C[C@@H]1CN(S(=O)(=O)c2ccccc2)CN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H18N2O4S2/c1-14-12-17(23(19,20)15-8-4-2-5-9-15)13-18(14)24(21,22)16-10-6-3-7-11-16/h2-11,14H,12-13H2,1H3/t14-/m1/s1 |
| InChIKey | SWJZYMIMFABQEN-CQSZACIVSA-N |
| XLogP | 1.73 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |