C15H16N2O4S2 — CID 1354022
1,3-bis(benzenesulfonyl)imidazolidine (PubChem CID 1354022) has the molecular formula C15H16N2O4S2 and a molecular weight of 352.44 g/mol. Its IUPAC name is 1,3-bis(benzenesulfonyl)imidazolidine.
| Compound Name | 1,3-bis(benzenesulfonyl)imidazolidine |
|---|---|
| PubChem CID | 1354022 |
| Molecular Formula | C15H16N2O4S2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 1,3-bis(benzenesulfonyl)imidazolidine |
| SMILES | O=S(=O)(c1ccccc1)N1CCN(S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C15H16N2O4S2/c18-22(19,14-7-3-1-4-8-14)16-11-12-17(13-16)23(20,21)15-9-5-2-6-10-15/h1-10H,11-13H2 |
| InChIKey | KNLXCRJELGBUSX-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |