C18H22N2O4S2 — CID 13382390
1,3-bis(benzenesulfonyl)-1,3-diazocane (PubChem CID 13382390) has the molecular formula C18H22N2O4S2 and a molecular weight of 394.52 g/mol. Its IUPAC name is 1,3-bis(benzenesulfonyl)-1,3-diazocane.
| Compound Name | 1,3-bis(benzenesulfonyl)-1,3-diazocane |
|---|---|
| PubChem CID | 13382390 |
| Molecular Formula | C18H22N2O4S2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 1,3-bis(benzenesulfonyl)-1,3-diazocane |
| SMILES | O=S(=O)(c1ccccc1)N1CCCCCN(S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C18H22N2O4S2/c21-25(22,17-10-4-1-5-11-17)19-14-8-3-9-15-20(16-19)26(23,24)18-12-6-2-7-13-18/h1-2,4-7,10-13H,3,8-9,14-16H2 |
| InChIKey | SRSQGYPTLWPVHR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |