C23H31N3O4S2 — CID 1167101
1-[4-(4-benzylpiperazin-1-yl)sulfonylphenyl]sulfonylazepane (PubChem CID 1167101) has the molecular formula C23H31N3O4S2 and a molecular weight of 477.65 g/mol. Its IUPAC name is 1-[4-(4-benzylpiperazin-1-yl)sulfonylphenyl]sulfonylazepane.
| Compound Name | 1-[4-(4-benzylpiperazin-1-yl)sulfonylphenyl]sulfonylazepane |
|---|---|
| PubChem CID | 1167101 |
| Molecular Formula | C23H31N3O4S2 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | 1-[4-(4-benzylpiperazin-1-yl)sulfonylphenyl]sulfonylazepane |
| SMILES | O=S(=O)(c1ccc(S(=O)(=O)N2CCN(Cc3ccccc3)CC2)cc1)N1CCCCCC1 |
| InChI | InChI=1S/C23H31N3O4S2/c27-31(28,25-14-6-1-2-7-15-25)22-10-12-23(13-11-22)32(29,30)26-18-16-24(17-19-26)20-21-8-4-3-5-9-21/h3-5,8-13H,1-2,6-7,14-20H2 |
| InChIKey | LCUIXGIFWIUYDO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |