C19H22N2O4S — CID 120613639
4-[(4-benzyl-1,4-diazepan-1-yl)sulfonyl]benzoic acid (PubChem CID 120613639) has the molecular formula C19H22N2O4S and a molecular weight of 374.46 g/mol. Its IUPAC name is 4-[(4-benzyl-1,4-diazepan-1-yl)sulfonyl]benzoic acid.
| Compound Name | 4-[(4-benzyl-1,4-diazepan-1-yl)sulfonyl]benzoic acid |
|---|---|
| PubChem CID | 120613639 |
| Molecular Formula | C19H22N2O4S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 4-[(4-benzyl-1,4-diazepan-1-yl)sulfonyl]benzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)N2CCCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C19H22N2O4S/c22-19(23)17-7-9-18(10-8-17)26(24,25)21-12-4-11-20(13-14-21)15-16-5-2-1-3-6-16/h1-3,5-10H,4,11-15H2,(H,22,23) |
| InChIKey | LQCWWIULPWWFDN-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |