C18H21BrN2O2S — CID 3819879
1-benzyl-4-(2-bromophenyl)sulfonyl-1,4-diazepane (PubChem CID 3819879) has the molecular formula C18H21BrN2O2S and a molecular weight of 409.35 g/mol. Its IUPAC name is 1-benzyl-4-(2-bromophenyl)sulfonyl-1,4-diazepane.
| Compound Name | 1-benzyl-4-(2-bromophenyl)sulfonyl-1,4-diazepane |
|---|---|
| PubChem CID | 3819879 |
| Molecular Formula | C18H21BrN2O2S |
| Molecular Weight | 409.35 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | 1-benzyl-4-(2-bromophenyl)sulfonyl-1,4-diazepane |
| SMILES | O=S(=O)(c1ccccc1Br)N1CCCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C18H21BrN2O2S/c19-17-9-4-5-10-18(17)24(22,23)21-12-6-11-20(13-14-21)15-16-7-2-1-3-8-16/h1-5,7-10H,6,11-15H2 |
| InChIKey | DUVPDPXIVLOGKM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.35 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |