C19H23BrN2O4S — CID 27658453
1-benzyl-4-(2-bromo-4,5-dimethoxyphenyl)sulfonylpiperazine (PubChem CID 27658453) has the molecular formula C19H23BrN2O4S and a molecular weight of 455.37 g/mol. Its IUPAC name is 1-benzyl-4-(2-bromo-4,5-dimethoxyphenyl)sulfonylpiperazine.
| Compound Name | 1-benzyl-4-(2-bromo-4,5-dimethoxyphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 27658453 |
| Molecular Formula | C19H23BrN2O4S |
| Molecular Weight | 455.37 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | 1-benzyl-4-(2-bromo-4,5-dimethoxyphenyl)sulfonylpiperazine |
| SMILES | COc1cc(Br)c(S(=O)(=O)N2CCN(Cc3ccccc3)CC2)cc1OC |
| InChI | InChI=1S/C19H23BrN2O4S/c1-25-17-12-16(20)19(13-18(17)26-2)27(23,24)22-10-8-21(9-11-22)14-15-6-4-3-5-7-15/h3-7,12-13H,8-11,14H2,1-2H3 |
| InChIKey | MWTQBNFAGYPLNX-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |