C17H19Cl3N2O2S — CID 2729556
1-benzyl-4-(2,3-dichlorophenyl)sulfonylpiperazine;hydrochloride (PubChem CID 2729556) has the molecular formula C17H19Cl3N2O2S and a molecular weight of 421.78 g/mol. Its IUPAC name is 1-benzyl-4-(2,3-dichlorophenyl)sulfonylpiperazine;hydrochloride.
| Compound Name | 1-benzyl-4-(2,3-dichlorophenyl)sulfonylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 2729556 |
| Molecular Formula | C17H19Cl3N2O2S |
| Molecular Weight | 421.78 g/mol |
| Exact Mass | 420.02 |
| IUPAC Name | 1-benzyl-4-(2,3-dichlorophenyl)sulfonylpiperazine;hydrochloride |
| SMILES | Cl.O=S(=O)(c1cccc(Cl)c1Cl)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C17H18Cl2N2O2S.ClH/c18-15-7-4-8-16(17(15)19)24(22,23)21-11-9-20(10-12-21)13-14-5-2-1-3-6-14;/h1-8H,9-13H2;1H |
| InChIKey | YZFMAVICMDIDLG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.78 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |