C19H22Cl2N2O3S — CID 27076001
2-[[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]methyl]-4,5-dimethylphenol (PubChem CID 27076001) has the molecular formula C19H22Cl2N2O3S and a molecular weight of 429.37 g/mol. Its IUPAC name is 2-[[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]methyl]-4,5-dimethylphenol.
| Compound Name | 2-[[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]methyl]-4,5-dimethylphenol |
|---|---|
| PubChem CID | 27076001 |
| Molecular Formula | C19H22Cl2N2O3S |
| Molecular Weight | 429.37 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | 2-[[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]methyl]-4,5-dimethylphenol |
| SMILES | Cc1cc(O)c(CN2CCN(S(=O)(=O)c3cccc(Cl)c3Cl)CC2)cc1C |
| InChI | InChI=1S/C19H22Cl2N2O3S/c1-13-10-15(17(24)11-14(13)2)12-22-6-8-23(9-7-22)27(25,26)18-5-3-4-16(20)19(18)21/h3-5,10-11,24H,6-9,12H2,1-2H3 |
| InChIKey | WEEQMQUUMINOTR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|