C22H29ClN2O3S — CID 167886526
5-chloro-2-[[4-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperazin-1-yl]methyl]phenol (PubChem CID 167886526) has the molecular formula C22H29ClN2O3S and a molecular weight of 437.01 g/mol. Its IUPAC name is 5-chloro-2-[[4-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperazin-1-yl]methyl]phenol.
| Compound Name | 5-chloro-2-[[4-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperazin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 167886526 |
| Molecular Formula | C22H29ClN2O3S |
| Molecular Weight | 437.01 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 5-chloro-2-[[4-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperazin-1-yl]methyl]phenol |
| SMILES | Cc1c(C)c(C)c(S(=O)(=O)N2CCN(Cc3ccc(Cl)cc3O)CC2)c(C)c1C |
| InChI | InChI=1S/C22H29ClN2O3S/c1-14-15(2)17(4)22(18(5)16(14)3)29(27,28)25-10-8-24(9-11-25)13-19-6-7-20(23)12-21(19)26/h6-7,12,26H,8-11,13H2,1-5H3 |
| InChIKey | LYEDZULDWPJGTQ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.01 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|