C21H29ClN2O2S — CID 71903213
1-benzyl-4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazine;hydrochloride (PubChem CID 71903213) has the molecular formula C21H29ClN2O2S and a molecular weight of 409.00 g/mol. Its IUPAC name is 1-benzyl-4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazine;hydrochloride.
| Compound Name | 1-benzyl-4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 71903213 |
| Molecular Formula | C21H29ClN2O2S |
| Molecular Weight | 409.00 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 1-benzyl-4-(2,3,5,6-tetramethylphenyl)sulfonylpiperazine;hydrochloride |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)N2CCN(Cc3ccccc3)CC2)c1C.Cl |
| InChI | InChI=1S/C21H28N2O2S.ClH/c1-16-14-17(2)19(4)21(18(16)3)26(24,25)23-12-10-22(11-13-23)15-20-8-6-5-7-9-20;/h5-9,14H,10-13,15H2,1-4H3;1H |
| InChIKey | IMGUEHGTGLVLRM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.00 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |