C17H28N2O2S — CID 19682857
1-ethyl-4-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperazine (PubChem CID 19682857) has the molecular formula C17H28N2O2S and a molecular weight of 324.49 g/mol. Its IUPAC name is 1-ethyl-4-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperazine.
| Compound Name | 1-ethyl-4-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 19682857 |
| Molecular Formula | C17H28N2O2S |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | 1-ethyl-4-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperazine |
| SMILES | CCN1CCN(S(=O)(=O)c2c(C)c(C)c(C)c(C)c2C)CC1 |
| InChI | InChI=1S/C17H28N2O2S/c1-7-18-8-10-19(11-9-18)22(20,21)17-15(5)13(3)12(2)14(4)16(17)6/h7-11H2,1-6H3 |
| InChIKey | WWHVMMALBQTAEP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |