C19H28F3N3O3S — CID 32711265
2-[4-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperazin-1-yl]-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 32711265) has the molecular formula C19H28F3N3O3S and a molecular weight of 435.51 g/mol. Its IUPAC name is 2-[4-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperazin-1-yl]-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[4-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperazin-1-yl]-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 32711265 |
| Molecular Formula | C19H28F3N3O3S |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 2-[4-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperazin-1-yl]-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | Cc1c(C)c(C)c(S(=O)(=O)N2CCN(CC(=O)NCC(F)(F)F)CC2)c(C)c1C |
| InChI | InChI=1S/C19H28F3N3O3S/c1-12-13(2)15(4)18(16(5)14(12)3)29(27,28)25-8-6-24(7-9-25)10-17(26)23-11-19(20,21)22/h6-11H2,1-5H3,(H,23,26) |
| InChIKey | CFDINLYTLGEIQN-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |