C19H27F3N2O4S — CID 55720089
1-[4-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperazin-1-yl]-2-(2,2,2-trifluoroethoxy)ethanone (PubChem CID 55720089) has the molecular formula C19H27F3N2O4S and a molecular weight of 436.50 g/mol. Its IUPAC name is 1-[4-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperazin-1-yl]-2-(2,2,2-trifluoroethoxy)ethanone.
| Compound Name | 1-[4-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperazin-1-yl]-2-(2,2,2-trifluoroethoxy)ethanone |
|---|---|
| PubChem CID | 55720089 |
| Molecular Formula | C19H27F3N2O4S |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 1-[4-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperazin-1-yl]-2-(2,2,2-trifluoroethoxy)ethanone |
| SMILES | Cc1c(C)c(C)c(S(=O)(=O)N2CCN(C(=O)COCC(F)(F)F)CC2)c(C)c1C |
| InChI | InChI=1S/C19H27F3N2O4S/c1-12-13(2)15(4)18(16(5)14(12)3)29(26,27)24-8-6-23(7-9-24)17(25)10-28-11-19(20,21)22/h6-11H2,1-5H3 |
| InChIKey | QPEXZCMZGOPNTO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |