C13H19Cl2N3O2S — CID 34781962
4-[(2,4-dichlorophenyl)methyl]-N,N-dimethylpiperazine-1-sulfonamide (PubChem CID 34781962) has the molecular formula C13H19Cl2N3O2S and a molecular weight of 352.29 g/mol. Its IUPAC name is 4-[(2,4-dichlorophenyl)methyl]-N,N-dimethylpiperazine-1-sulfonamide.
| Compound Name | 4-[(2,4-dichlorophenyl)methyl]-N,N-dimethylpiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 34781962 |
| Molecular Formula | C13H19Cl2N3O2S |
| Molecular Weight | 352.29 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | 4-[(2,4-dichlorophenyl)methyl]-N,N-dimethylpiperazine-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCN(Cc2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C13H19Cl2N3O2S/c1-16(2)21(19,20)18-7-5-17(6-8-18)10-11-3-4-12(14)9-13(11)15/h3-4,9H,5-8,10H2,1-2H3 |
| InChIKey | YUZJDPJUXKNLEJ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.29 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |