C15H21Cl2N3S — CID 63342622
2-[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]-2-methylpropanethioamide (PubChem CID 63342622) has the molecular formula C15H21Cl2N3S and a molecular weight of 346.33 g/mol. Its IUPAC name is 2-[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]-2-methylpropanethioamide.
| Compound Name | 2-[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]-2-methylpropanethioamide |
|---|---|
| PubChem CID | 63342622 |
| Molecular Formula | C15H21Cl2N3S |
| Molecular Weight | 346.33 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 2-[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]-2-methylpropanethioamide |
| SMILES | CC(C)(C(N)=S)N1CCN(Cc2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C15H21Cl2N3S/c1-15(2,14(18)21)20-7-5-19(6-8-20)10-11-3-4-12(16)9-13(11)17/h3-4,9H,5-8,10H2,1-2H3,(H2,18,21) |
| InChIKey | RBSKHJSTFCDEPC-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|