C12H15ClN2OS2 — CID 102666137
3-chloro-4-[(1-oxo-1,4-thiazinan-4-yl)methyl]benzenecarbothioamide (PubChem CID 102666137) has the molecular formula C12H15ClN2OS2 and a molecular weight of 302.85 g/mol. Its IUPAC name is 3-chloro-4-[(1-oxo-1,4-thiazinan-4-yl)methyl]benzenecarbothioamide.
| Compound Name | 3-chloro-4-[(1-oxo-1,4-thiazinan-4-yl)methyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 102666137 |
| Molecular Formula | C12H15ClN2OS2 |
| Molecular Weight | 302.85 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | 3-chloro-4-[(1-oxo-1,4-thiazinan-4-yl)methyl]benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(CN2CCS(=O)CC2)c(Cl)c1 |
| InChI | InChI=1S/C12H15ClN2OS2/c13-11-7-9(12(14)17)1-2-10(11)8-15-3-5-18(16)6-4-15/h1-2,7H,3-6,8H2,(H2,14,17) |
| InChIKey | GUQXCJCBHTWGPR-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.85 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|