C17H23ClN2S — CID 102666075
4-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ylmethyl)-3-chlorobenzenecarbothioamide (PubChem CID 102666075) has the molecular formula C17H23ClN2S and a molecular weight of 322.90 g/mol. Its IUPAC name is 4-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ylmethyl)-3-chlorobenzenecarbothioamide.
| Compound Name | 4-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ylmethyl)-3-chlorobenzenecarbothioamide |
|---|---|
| PubChem CID | 102666075 |
| Molecular Formula | C17H23ClN2S |
| Molecular Weight | 322.90 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 4-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ylmethyl)-3-chlorobenzenecarbothioamide |
| SMILES | NC(=S)c1ccc(CN2CCC3CCCCC3C2)c(Cl)c1 |
| InChI | InChI=1S/C17H23ClN2S/c18-16-9-13(17(19)21)5-6-15(16)11-20-8-7-12-3-1-2-4-14(12)10-20/h5-6,9,12,14H,1-4,7-8,10-11H2,(H2,19,21) |
| InChIKey | KPXGAZAGDQXPBN-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.90 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|