C15H21ClN2S — CID 102666268
3-chloro-4-[(3,3-dimethylpiperidin-1-yl)methyl]benzenecarbothioamide (PubChem CID 102666268) has the molecular formula C15H21ClN2S and a molecular weight of 296.87 g/mol. Its IUPAC name is 3-chloro-4-[(3,3-dimethylpiperidin-1-yl)methyl]benzenecarbothioamide.
| Compound Name | 3-chloro-4-[(3,3-dimethylpiperidin-1-yl)methyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 102666268 |
| Molecular Formula | C15H21ClN2S |
| Molecular Weight | 296.87 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 3-chloro-4-[(3,3-dimethylpiperidin-1-yl)methyl]benzenecarbothioamide |
| SMILES | CC1(C)CCCN(Cc2ccc(C(N)=S)cc2Cl)C1 |
| InChI | InChI=1S/C15H21ClN2S/c1-15(2)6-3-7-18(10-15)9-12-5-4-11(14(17)19)8-13(12)16/h4-5,8H,3,6-7,9-10H2,1-2H3,(H2,17,19) |
| InChIKey | YTNJAWGMIKFRJE-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.87 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|