C19H19Cl2NO — CID 59278521
(3-chloro-4-methylphenyl)-[3-chloro-4-(pyrrolidin-1-ylmethyl)phenyl]methanone (PubChem CID 59278521) has the molecular formula C19H19Cl2NO and a molecular weight of 348.27 g/mol. Its IUPAC name is (3-chloro-4-methylphenyl)-[3-chloro-4-(pyrrolidin-1-ylmethyl)phenyl]methanone.
| Compound Name | (3-chloro-4-methylphenyl)-[3-chloro-4-(pyrrolidin-1-ylmethyl)phenyl]methanone |
|---|---|
| PubChem CID | 59278521 |
| Molecular Formula | C19H19Cl2NO |
| Molecular Weight | 348.27 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | (3-chloro-4-methylphenyl)-[3-chloro-4-(pyrrolidin-1-ylmethyl)phenyl]methanone |
| SMILES | Cc1ccc(C(=O)c2ccc(CN3CCCC3)c(Cl)c2)cc1Cl |
| InChI | InChI=1S/C19H19Cl2NO/c1-13-4-5-14(10-17(13)20)19(23)15-6-7-16(18(21)11-15)12-22-8-2-3-9-22/h4-7,10-11H,2-3,8-9,12H2,1H3 |
| InChIKey | SRNKCIIXKPIQHS-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.27 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |