3-chloro-4-[(4,4-diethylpiperidin-1-yl)methyl]benzoic acid

C17H24ClNO2 — CID 102669962

IUPAC3-chloro-4-[(4,4-diethylpiperidin-1-yl)methyl]benzoic acid
SMILESCCC1(CC)CCN(Cc2ccc(C(=O)O)cc2Cl)CC1
InChIInChI=1S/C17H24ClNO2/c1-3-17(4-2)7-9-19(10-8-17)12-14-6-5-13(16(20)21)11-15(14)18/h5-6,11H,3-4,7-10,12H2,1-2H3,(H,20,21)
InChIKeyPJUDHVFPUJOZBH-UHFFFAOYSA-N
MW309.84 g/mol
LogP4.44
Rot. Bonds5

About 3-chloro-4-[(4,4-diethylpiperidin-1-yl)methyl]benzoic acid

3-chloro-4-[(4,4-diethylpiperidin-1-yl)methyl]benzoic acid (PubChem CID 102669962) has the molecular formula C17H24ClNO2 and a molecular weight of 309.84 g/mol. Its IUPAC name is 3-chloro-4-[(4,4-diethylpiperidin-1-yl)methyl]benzoic acid.

Molecular Properties

Compound Name3-chloro-4-[(4,4-diethylpiperidin-1-yl)methyl]benzoic acid
PubChem CID102669962
Molecular FormulaC17H24ClNO2
Molecular Weight309.84 g/mol
Exact Mass309.15
IUPAC Name3-chloro-4-[(4,4-diethylpiperidin-1-yl)methyl]benzoic acid
SMILESCCC1(CC)CCN(Cc2ccc(C(=O)O)cc2Cl)CC1
InChIInChI=1S/C17H24ClNO2/c1-3-17(4-2)7-9-19(10-8-17)12-14-6-5-13(16(20)21)11-15(14)18/h5-6,11H,3-4,7-10,12H2,1-2H3,(H,20,21)
InChIKeyPJUDHVFPUJOZBH-UHFFFAOYSA-N
XLogP4.44
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500309.84
LogP ≤ 54.44
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3-chloro-4-[(4,4-diethylpiperidin-1-yl)methyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-chloro-4-[(4,4-diethylpiperidin-1-yl)methyl]benzoic acid?
The IUPAC name of 3-chloro-4-[(4,4-diethylpiperidin-1-yl)methyl]benzoic acid (CID 102669962) is 3-chloro-4-[(4,4-diethylpiperidin-1-yl)methyl]benzoic acid.
What is the SMILES notation for 3-chloro-4-[(4,4-diethylpiperidin-1-yl)methyl]benzoic acid?
The canonical SMILES for 3-chloro-4-[(4,4-diethylpiperidin-1-yl)methyl]benzoic acid is CCC1(CC)CCN(Cc2ccc(C(=O)O)cc2Cl)CC1.
What is the InChIKey of 3-chloro-4-[(4,4-diethylpiperidin-1-yl)methyl]benzoic acid?
The InChIKey is PJUDHVFPUJOZBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24ClNO2/c1-3-17(4-2)7-9-19(10-8-17)12-14-6-5-13(16(20)21)11-15(14)18/h5-6,11H,3-4,7-10,12H2,1-2H3,(H,20,21).
What are the key properties of 3-chloro-4-[(4,4-diethylpiperidin-1-yl)methyl]benzoic acid?
3-chloro-4-[(4,4-diethylpiperidin-1-yl)methyl]benzoic acid has a molecular weight of 309.84 g/mol, XLogP of 4.44, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-[(4,4-diethylpiperidin-1-yl)methyl]benzoic acid is sourced from PubChem (CID 102669962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).