C13H14ClF2NO2 — CID 166594026
3-chloro-4-[(4,4-difluoropiperidin-1-yl)methyl]benzoic acid (PubChem CID 166594026) has the molecular formula C13H14ClF2NO2 and a molecular weight of 289.71 g/mol. Its IUPAC name is 3-chloro-4-[(4,4-difluoropiperidin-1-yl)methyl]benzoic acid.
| Compound Name | 3-chloro-4-[(4,4-difluoropiperidin-1-yl)methyl]benzoic acid |
|---|---|
| PubChem CID | 166594026 |
| Molecular Formula | C13H14ClF2NO2 |
| Molecular Weight | 289.71 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 3-chloro-4-[(4,4-difluoropiperidin-1-yl)methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CN2CCC(F)(F)CC2)c(Cl)c1 |
| InChI | InChI=1S/C13H14ClF2NO2/c14-11-7-9(12(18)19)1-2-10(11)8-17-5-3-13(15,16)4-6-17/h1-2,7H,3-6,8H2,(H,18,19) |
| InChIKey | LIACPIFOFDGTAA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.71 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |