C13H14ClNO3 — CID 117422866
2-[3-chloro-4-(pyrrolidin-1-ylmethyl)phenyl]-2-oxoacetic acid (PubChem CID 117422866) has the molecular formula C13H14ClNO3 and a molecular weight of 267.71 g/mol. Its IUPAC name is 2-[3-chloro-4-(pyrrolidin-1-ylmethyl)phenyl]-2-oxoacetic acid.
| Compound Name | 2-[3-chloro-4-(pyrrolidin-1-ylmethyl)phenyl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 117422866 |
| Molecular Formula | C13H14ClNO3 |
| Molecular Weight | 267.71 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 2-[3-chloro-4-(pyrrolidin-1-ylmethyl)phenyl]-2-oxoacetic acid |
| SMILES | O=C(O)C(=O)c1ccc(CN2CCCC2)c(Cl)c1 |
| InChI | InChI=1S/C13H14ClNO3/c14-11-7-9(12(16)13(17)18)3-4-10(11)8-15-5-1-2-6-15/h3-4,7H,1-2,5-6,8H2,(H,17,18) |
| InChIKey | FWFVRWQYKKCPJF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.71 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|